C31H29Cl2N3O4 — CID 6185241
2,4-dichloro-N-[1-[(2Z)-2-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 6185241) has the molecular formula C31H29Cl2N3O4 and a molecular weight of 578.50 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[(2Z)-2-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[(2Z)-2-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 6185241 |
| Molecular Formula | C31H29Cl2N3O4 |
| Molecular Weight | 578.50 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | 2,4-dichloro-N-[1-[(2Z)-2-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)C(NC(=O)c2ccc(Cl)cc2Cl)C(C)C)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C31H29Cl2N3O4/c1-19(2)29(35-30(37)25-13-12-23(32)16-26(25)33)31(38)36-34-17-20-11-14-27(28(15-20)39-3)40-18-22-9-6-8-21-7-4-5-10-24(21)22/h4-17,19,29H,18H2,1-3H3,(H,35,37)(H,36,38)/b34-17- |
| InChIKey | VWVRKVLITXJIIN-DLCNMLRHSA-N |
| XLogP | 6.64 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.50 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|