C26H23Cl4N3O3 — CID 3483297
2,4-dichloro-N-[1-[2-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 3483297) has the molecular formula C26H23Cl4N3O3 and a molecular weight of 567.30 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[2-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[2-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 3483297 |
| Molecular Formula | C26H23Cl4N3O3 |
| Molecular Weight | 567.30 g/mol |
| Exact Mass | 565.05 |
| IUPAC Name | 2,4-dichloro-N-[1-[2-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)cc1Cl)C(=O)NN=Cc1ccccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H23Cl4N3O3/c1-15(2)24(32-25(34)20-10-9-19(28)12-22(20)30)26(35)33-31-13-16-5-3-4-6-23(16)36-14-17-7-8-18(27)11-21(17)29/h3-13,15,24H,14H2,1-2H3,(H,32,34)(H,33,35) |
| InChIKey | ANJIQYMDOFJBBA-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.30 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|