C24H26Cl2N4O2 — CID 126165383
2,4-dichloro-N-[(2R)-3-methyl-1-oxo-1-[(2Z)-2-[(1-propan-2-ylindol-3-yl)methylidene]hydrazinyl]butan-2-yl]benzamide (PubChem CID 126165383) has the molecular formula C24H26Cl2N4O2 and a molecular weight of 473.40 g/mol. Its IUPAC name is 2,4-dichloro-N-[(2R)-3-methyl-1-oxo-1-[(2Z)-2-[(1-propan-2-ylindol-3-yl)methylidene]hydrazinyl]butan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[(2R)-3-methyl-1-oxo-1-[(2Z)-2-[(1-propan-2-ylindol-3-yl)methylidene]hydrazinyl]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 126165383 |
| Molecular Formula | C24H26Cl2N4O2 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 2,4-dichloro-N-[(2R)-3-methyl-1-oxo-1-[(2Z)-2-[(1-propan-2-ylindol-3-yl)methylidene]hydrazinyl]butan-2-yl]benzamide |
| SMILES | CC(C)[C@@H](NC(=O)c1ccc(Cl)cc1Cl)C(=O)N/N=C\c1cn(C(C)C)c2ccccc12 |
| InChI | InChI=1S/C24H26Cl2N4O2/c1-14(2)22(28-23(31)19-10-9-17(25)11-20(19)26)24(32)29-27-12-16-13-30(15(3)4)21-8-6-5-7-18(16)21/h5-15,22H,1-4H3,(H,28,31)(H,29,32)/b27-12-/t22-/m1/s1 |
| InChIKey | UWZLYFKTYHODSQ-BOGNPUBTSA-N |
| XLogP | 5.43 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|