C28H25Cl2FN4O2 — CID 6080267
2,4-dichloro-N-[1-[(2Z)-2-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 6080267) has the molecular formula C28H25Cl2FN4O2 and a molecular weight of 539.44 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[(2Z)-2-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[(2Z)-2-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 6080267 |
| Molecular Formula | C28H25Cl2FN4O2 |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 2,4-dichloro-N-[1-[(2Z)-2-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)cc1Cl)C(=O)N/N=C\c1cn(Cc2ccccc2F)c2ccccc12 |
| InChI | InChI=1S/C28H25Cl2FN4O2/c1-17(2)26(33-27(36)22-12-11-20(29)13-23(22)30)28(37)34-32-14-19-16-35(25-10-6-4-8-21(19)25)15-18-7-3-5-9-24(18)31/h3-14,16-17,26H,15H2,1-2H3,(H,33,36)(H,34,37)/b32-14- |
| InChIKey | ALQAKWPKUBOGPL-LPEPFOFCSA-N |
| XLogP | 6.04 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|