C29H26Cl2N4O4 — CID 6364275
N-[(2S)-1-[(2Z)-2-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 6364275) has the molecular formula C29H26Cl2N4O4 and a molecular weight of 565.46 g/mol. Its IUPAC name is N-[(2S)-1-[(2Z)-2-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(2S)-1-[(2Z)-2-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 6364275 |
| Molecular Formula | C29H26Cl2N4O4 |
| Molecular Weight | 565.46 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | N-[(2S)-1-[(2Z)-2-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc2c(c1)OCO2)C(=O)N/N=C\c1cn(Cc2ccc(Cl)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C29H26Cl2N4O4/c1-17(2)27(33-28(36)19-8-10-25-26(12-19)39-16-38-25)29(37)34-32-13-20-15-35(24-6-4-3-5-21(20)24)14-18-7-9-22(30)23(31)11-18/h3-13,15,17,27H,14,16H2,1-2H3,(H,33,36)(H,34,37)/b32-13-/t27-/m0/s1 |
| InChIKey | ZLTXHCUNWSWVSC-QVRODWBRSA-N |
| XLogP | 5.63 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|