C23H16Cl3N3O — CID 21379735
4-chloro-N-[(E)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]benzamide (PubChem CID 21379735) has the molecular formula C23H16Cl3N3O and a molecular weight of 456.76 g/mol. Its IUPAC name is 4-chloro-N-[(E)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(E)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 21379735 |
| Molecular Formula | C23H16Cl3N3O |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 4-chloro-N-[(E)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cn(Cc2ccc(Cl)c(Cl)c2)c2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H16Cl3N3O/c24-18-8-6-16(7-9-18)23(30)28-27-12-17-14-29(22-4-2-1-3-19(17)22)13-15-5-10-20(25)21(26)11-15/h1-12,14H,13H2,(H,28,30)/b27-12+ |
| InChIKey | FSBLQACUHJWIPH-KKMKTNMSSA-N |
| XLogP | 6.41 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|