C25H23N3O — CID 126274795
3-methyl-N-[(Z)-[1-[(4-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide (PubChem CID 126274795) has the molecular formula C25H23N3O and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-methyl-N-[(Z)-[1-[(4-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide.
| Compound Name | 3-methyl-N-[(Z)-[1-[(4-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126274795 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 3-methyl-N-[(Z)-[1-[(4-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1ccc(Cn2cc(/C=N\NC(=O)c3cccc(C)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H23N3O/c1-18-10-12-20(13-11-18)16-28-17-22(23-8-3-4-9-24(23)28)15-26-27-25(29)21-7-5-6-19(2)14-21/h3-15,17H,16H2,1-2H3,(H,27,29)/b26-15- |
| InChIKey | WVANJAYCTXSHSU-YSMPRRRNSA-N |
| XLogP | 5.07 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|