C25H21Br2N3O2 — CID 3734601
3,5-dibromo-4-methoxy-N-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide (PubChem CID 3734601) has the molecular formula C25H21Br2N3O2 and a molecular weight of 555.27 g/mol. Its IUPAC name is 3,5-dibromo-4-methoxy-N-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide.
| Compound Name | 3,5-dibromo-4-methoxy-N-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3734601 |
| Molecular Formula | C25H21Br2N3O2 |
| Molecular Weight | 555.27 g/mol |
| Exact Mass | 553.00 |
| IUPAC Name | 3,5-dibromo-4-methoxy-N-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide |
| SMILES | COc1c(Br)cc(C(=O)NN=Cc2cn(Cc3cccc(C)c3)c3ccccc23)cc1Br |
| InChI | InChI=1S/C25H21Br2N3O2/c1-16-6-5-7-17(10-16)14-30-15-19(20-8-3-4-9-23(20)30)13-28-29-25(31)18-11-21(26)24(32-2)22(27)12-18/h3-13,15H,14H2,1-2H3,(H,29,31) |
| InChIKey | KUEWOMRBOWNAIE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.27 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|