C30H28N4O — CID 126008005
4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-[1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide (PubChem CID 126008005) has the molecular formula C30H28N4O and a molecular weight of 460.58 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-[1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide.
| Compound Name | 4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-[1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126008005 |
| Molecular Formula | C30H28N4O |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-[1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1cccc(Cn2cc(/C=N\NC(=O)c3ccc(-n4c(C)ccc4C)cc3)c3ccccc32)c1 |
| InChI | InChI=1S/C30H28N4O/c1-21-7-6-8-24(17-21)19-33-20-26(28-9-4-5-10-29(28)33)18-31-32-30(35)25-13-15-27(16-14-25)34-22(2)11-12-23(34)3/h4-18,20H,19H2,1-3H3,(H,32,35)/b31-18- |
| InChIKey | POKAFUSNTRAPCN-MNBJERMJSA-N |
| XLogP | 6.17 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|