C30H32N4O2 — CID 3965951
4-methyl-N-[3-methyl-1-[2-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide (PubChem CID 3965951) has the molecular formula C30H32N4O2 and a molecular weight of 480.61 g/mol. Its IUPAC name is 4-methyl-N-[3-methyl-1-[2-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-methyl-N-[3-methyl-1-[2-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 3965951 |
| Molecular Formula | C30H32N4O2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 4-methyl-N-[3-methyl-1-[2-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(C(=O)NN=Cc2cn(Cc3cccc(C)c3)c3ccccc23)C(C)C)cc1 |
| InChI | InChI=1S/C30H32N4O2/c1-20(2)28(32-29(35)24-14-12-21(3)13-15-24)30(36)33-31-17-25-19-34(27-11-6-5-10-26(25)27)18-23-9-7-8-22(4)16-23/h5-17,19-20,28H,18H2,1-4H3,(H,32,35)(H,33,36) |
| InChIKey | UYAQSYIRWNDPHB-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|