C27H29N3O3 — CID 3486870
N-[3-methyl-1-[2-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide (PubChem CID 3486870) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[3-methyl-1-[2-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide.
| Compound Name | N-[3-methyl-1-[2-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 3486870 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-[3-methyl-1-[2-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
| SMILES | Cc1cccc(COc2ccc(C=NNC(=O)C(NC(=O)c3ccccc3)C(C)C)cc2)c1 |
| InChI | InChI=1S/C27H29N3O3/c1-19(2)25(29-26(31)23-10-5-4-6-11-23)27(32)30-28-17-21-12-14-24(15-13-21)33-18-22-9-7-8-20(3)16-22/h4-17,19,25H,18H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | LUENQMQFYINENT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|