C27H27N3O2 — CID 3483141
N-[(1-benzylindol-3-yl)methylideneamino]-4-butoxybenzamide (PubChem CID 3483141) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[(1-benzylindol-3-yl)methylideneamino]-4-butoxybenzamide.
| Compound Name | N-[(1-benzylindol-3-yl)methylideneamino]-4-butoxybenzamide |
|---|---|
| PubChem CID | 3483141 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[(1-benzylindol-3-yl)methylideneamino]-4-butoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)NN=Cc2cn(Cc3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C27H27N3O2/c1-2-3-17-32-24-15-13-22(14-16-24)27(31)29-28-18-23-20-30(19-21-9-5-4-6-10-21)26-12-8-7-11-25(23)26/h4-16,18,20H,2-3,17,19H2,1H3,(H,29,31) |
| InChIKey | ZDIOJUDZEQMHJO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|