C23H17N5O2 — CID 45108977
N-[(E)-(1-benzylindol-3-yl)methylideneamino]-2,1,3-benzoxadiazole-5-carboxamide (PubChem CID 45108977) has the molecular formula C23H17N5O2 and a molecular weight of 395.42 g/mol. Its IUPAC name is N-[(E)-(1-benzylindol-3-yl)methylideneamino]-2,1,3-benzoxadiazole-5-carboxamide.
| Compound Name | N-[(E)-(1-benzylindol-3-yl)methylideneamino]-2,1,3-benzoxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 45108977 |
| Molecular Formula | C23H17N5O2 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-[(E)-(1-benzylindol-3-yl)methylideneamino]-2,1,3-benzoxadiazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1cn(Cc2ccccc2)c2ccccc12)c1ccc2nonc2c1 |
| InChI | InChI=1S/C23H17N5O2/c29-23(17-10-11-20-21(12-17)27-30-26-20)25-24-13-18-15-28(14-16-6-2-1-3-7-16)22-9-5-4-8-19(18)22/h1-13,15H,14H2,(H,25,29)/b24-13+ |
| InChIKey | QQDVVBVZQWIDGC-ZMOGYAJESA-N |
| XLogP | 3.99 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|