C17H13N5O2 — CID 45109248
N-[(E)-(1-methylindol-3-yl)methylideneamino]-2,1,3-benzoxadiazole-5-carboxamide (PubChem CID 45109248) has the molecular formula C17H13N5O2 and a molecular weight of 319.32 g/mol. Its IUPAC name is N-[(E)-(1-methylindol-3-yl)methylideneamino]-2,1,3-benzoxadiazole-5-carboxamide.
| Compound Name | N-[(E)-(1-methylindol-3-yl)methylideneamino]-2,1,3-benzoxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 45109248 |
| Molecular Formula | C17H13N5O2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-[(E)-(1-methylindol-3-yl)methylideneamino]-2,1,3-benzoxadiazole-5-carboxamide |
| SMILES | Cn1cc(/C=N/NC(=O)c2ccc3nonc3c2)c2ccccc21 |
| InChI | InChI=1S/C17H13N5O2/c1-22-10-12(13-4-2-3-5-16(13)22)9-18-19-17(23)11-6-7-14-15(8-11)21-24-20-14/h2-10H,1H3,(H,19,23)/b18-9+ |
| InChIKey | AKKHWHJDMYVCBY-GIJQJNRQSA-N |
| XLogP | 2.48 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|