C16H14N4O4 — CID 6735610
N-[(3,5-dimethoxyphenyl)methylideneamino]-2,1,3-benzoxadiazole-5-carboxamide (PubChem CID 6735610) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methylideneamino]-2,1,3-benzoxadiazole-5-carboxamide.
| Compound Name | N-[(3,5-dimethoxyphenyl)methylideneamino]-2,1,3-benzoxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 6735610 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methylideneamino]-2,1,3-benzoxadiazole-5-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc3nonc3c2)cc(OC)c1 |
| InChI | InChI=1S/C16H14N4O4/c1-22-12-5-10(6-13(8-12)23-2)9-17-18-16(21)11-3-4-14-15(7-11)20-24-19-14/h3-9H,1-2H3,(H,18,21) |
| InChIKey | ZWIQPSQMRPZQGL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|