C20H24N2O3 — CID 7414381
4-tert-butyl-N-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]benzamide (PubChem CID 7414381) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 4-tert-butyl-N-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-tert-butyl-N-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 7414381 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 4-tert-butyl-N-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc(C(C)(C)C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C20H24N2O3/c1-20(2,3)16-8-6-15(7-9-16)19(23)22-21-13-14-10-17(24-4)12-18(11-14)25-5/h6-13H,1-5H3,(H,22,23)/b21-13- |
| InChIKey | VEZFPILZFOJQQL-BKUYFWCQSA-N |
| XLogP | 3.77 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|