C30H28N4O6 — CID 139088138
4-hydroxy-N-[(E)-(3-methoxyphenyl)methylideneamino]benzamide (PubChem CID 139088138) has the molecular formula C30H28N4O6 and a molecular weight of 540.58 g/mol. Its IUPAC name is 4-hydroxy-N-[(E)-(3-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-hydroxy-N-[(E)-(3-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 139088138 |
| Molecular Formula | C30H28N4O6 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 4-hydroxy-N-[(E)-(3-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cccc(/C=N/NC(=O)c2ccc(O)cc2)c1.COc1cccc(/C=N/NC(=O)c2ccc(O)cc2)c1 |
| InChI | InChI=1S/2C15H14N2O3/c2*1-20-14-4-2-3-11(9-14)10-16-17-15(19)12-5-7-13(18)8-6-12/h2*2-10,18H,1H3,(H,17,19)/b2*16-10+ |
| InChIKey | ANAGFZQERUTBHJ-UDGBXGIMSA-N |
| XLogP | 4.33 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|