C27H29N5O4 — CID 89119419
N-[(E)-(3-methoxyphenyl)methylideneamino]-4-[[4-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide (PubChem CID 89119419) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is N-[(E)-(3-methoxyphenyl)methylideneamino]-4-[[4-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide.
| Compound Name | N-[(E)-(3-methoxyphenyl)methylideneamino]-4-[[4-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide |
|---|---|
| PubChem CID | 89119419 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | N-[(E)-(3-methoxyphenyl)methylideneamino]-4-[[4-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide |
| SMILES | COc1cccc(/C=N/NC(=O)CCCNc2ccc(C(=O)N/N=C/c3cccc(OC)c3)cc2)c1 |
| InChI | InChI=1S/C27H29N5O4/c1-35-24-8-3-6-20(16-24)18-29-31-26(33)10-5-15-28-23-13-11-22(12-14-23)27(34)32-30-19-21-7-4-9-25(17-21)36-2/h3-4,6-9,11-14,16-19,28H,5,10,15H2,1-2H3,(H,31,33)(H,32,34)/b29-18+,30-19+ |
| InChIKey | HIVQHBUQFYUIEQ-ZZASANORSA-N |
| XLogP | 3.81 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|