C31H39N5O2 — CID 143915628
N-[(E)-(3,5-dimethylphenyl)methylideneamino]-4-[[4-[(2E)-2-[(3,5-dimethylphenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide;ethane (PubChem CID 143915628) has the molecular formula C31H39N5O2 and a molecular weight of 513.69 g/mol. Its IUPAC name is N-[(E)-(3,5-dimethylphenyl)methylideneamino]-4-[[4-[(2E)-2-[(3,5-dimethylphenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide;ethane.
| Compound Name | N-[(E)-(3,5-dimethylphenyl)methylideneamino]-4-[[4-[(2E)-2-[(3,5-dimethylphenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide;ethane |
|---|---|
| PubChem CID | 143915628 |
| Molecular Formula | C31H39N5O2 |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | N-[(E)-(3,5-dimethylphenyl)methylideneamino]-4-[[4-[(2E)-2-[(3,5-dimethylphenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide;ethane |
| SMILES | CC.Cc1cc(C)cc(/C=N/NC(=O)CCCNc2ccc(C(=O)N/N=C/c3cc(C)cc(C)c3)cc2)c1 |
| InChI | InChI=1S/C29H33N5O2.C2H6/c1-20-12-21(2)15-24(14-20)18-31-33-28(35)6-5-11-30-27-9-7-26(8-10-27)29(36)34-32-19-25-16-22(3)13-23(4)17-25;1-2/h7-10,12-19,30H,5-6,11H2,1-4H3,(H,33,35)(H,34,36);1-2H3/b31-18+,32-19+; |
| InChIKey | LFMZJQNWDCHAAP-QYUBTDHISA-N |
| XLogP | 6.05 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|