C27H23N7O2 — CID 44621355
N-[(E)-(3-cyanophenyl)methylideneamino]-4-[[4-[(2E)-2-[(3-cyanophenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide (PubChem CID 44621355) has the molecular formula C27H23N7O2 and a molecular weight of 477.53 g/mol. Its IUPAC name is N-[(E)-(3-cyanophenyl)methylideneamino]-4-[[4-[(2E)-2-[(3-cyanophenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide.
| Compound Name | N-[(E)-(3-cyanophenyl)methylideneamino]-4-[[4-[(2E)-2-[(3-cyanophenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide |
|---|---|
| PubChem CID | 44621355 |
| Molecular Formula | C27H23N7O2 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-[(E)-(3-cyanophenyl)methylideneamino]-4-[[4-[(2E)-2-[(3-cyanophenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide |
| SMILES | N#Cc1cccc(/C=N/NC(=O)CCCNc2ccc(C(=O)N/N=C/c3cccc(C#N)c3)cc2)c1 |
| InChI | InChI=1S/C27H23N7O2/c28-16-20-4-1-6-22(14-20)18-31-33-26(35)8-3-13-30-25-11-9-24(10-12-25)27(36)34-32-19-23-7-2-5-21(15-23)17-29/h1-2,4-7,9-12,14-15,18-19,30H,3,8,13H2,(H,33,35)(H,34,36)/b31-18+,32-19+ |
| InChIKey | ASAGDNKMKWHSSU-QCPYDNSOSA-N |
| XLogP | 3.54 |
| TPSA | 142.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|