C29H35N7O2 — CID 68905297
N-[[3-(dimethylamino)phenyl]methylideneamino]-4-[[4-[2-[[3-(dimethylamino)phenyl]methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide (PubChem CID 68905297) has the molecular formula C29H35N7O2 and a molecular weight of 513.65 g/mol. Its IUPAC name is N-[[3-(dimethylamino)phenyl]methylideneamino]-4-[[4-[2-[[3-(dimethylamino)phenyl]methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide.
| Compound Name | N-[[3-(dimethylamino)phenyl]methylideneamino]-4-[[4-[2-[[3-(dimethylamino)phenyl]methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide |
|---|---|
| PubChem CID | 68905297 |
| Molecular Formula | C29H35N7O2 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | N-[[3-(dimethylamino)phenyl]methylideneamino]-4-[[4-[2-[[3-(dimethylamino)phenyl]methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide |
| SMILES | CN(C)c1cccc(C=NNC(=O)CCCNc2ccc(C(=O)NN=Cc3cccc(N(C)C)c3)cc2)c1 |
| InChI | InChI=1S/C29H35N7O2/c1-35(2)26-10-5-8-22(18-26)20-31-33-28(37)12-7-17-30-25-15-13-24(14-16-25)29(38)34-32-21-23-9-6-11-27(19-23)36(3)4/h5-6,8-11,13-16,18-21,30H,7,12,17H2,1-4H3,(H,33,37)(H,34,38) |
| InChIKey | HSOCFOWEHCIPLF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|