C27H27F2N5O4 — CID 44621289
N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-4-[[4-[(2E)-2-[(4-fluoro-3-methoxyphenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide (PubChem CID 44621289) has the molecular formula C27H27F2N5O4 and a molecular weight of 523.54 g/mol. Its IUPAC name is N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-4-[[4-[(2E)-2-[(4-fluoro-3-methoxyphenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide.
| Compound Name | N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-4-[[4-[(2E)-2-[(4-fluoro-3-methoxyphenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide |
|---|---|
| PubChem CID | 44621289 |
| Molecular Formula | C27H27F2N5O4 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-4-[[4-[(2E)-2-[(4-fluoro-3-methoxyphenyl)methylidene]hydrazinyl]-4-oxobutyl]amino]benzamide |
| SMILES | COc1cc(/C=N/NC(=O)CCCNc2ccc(C(=O)N/N=C/c3ccc(F)c(OC)c3)cc2)ccc1F |
| InChI | InChI=1S/C27H27F2N5O4/c1-37-24-14-18(5-11-22(24)28)16-31-33-26(35)4-3-13-30-21-9-7-20(8-10-21)27(36)34-32-17-19-6-12-23(29)25(15-19)38-2/h5-12,14-17,30H,3-4,13H2,1-2H3,(H,33,35)(H,34,36)/b31-16+,32-17+ |
| InChIKey | IAWPSSPYYBTPJF-LCTMICICSA-N |
| XLogP | 4.09 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|