C25H25N5O4 — CID 143915664
N-[(E)-(3-hydroxyphenyl)methylideneamino]-4-[[3-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]amino]benzamide (PubChem CID 143915664) has the molecular formula C25H25N5O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is N-[(E)-(3-hydroxyphenyl)methylideneamino]-4-[[3-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]amino]benzamide.
| Compound Name | N-[(E)-(3-hydroxyphenyl)methylideneamino]-4-[[3-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]amino]benzamide |
|---|---|
| PubChem CID | 143915664 |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | N-[(E)-(3-hydroxyphenyl)methylideneamino]-4-[[3-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]amino]benzamide |
| SMILES | COc1cccc(/C=N/NC(=O)CCNc2ccc(C(=O)N/N=C/c3cccc(O)c3)cc2)c1 |
| InChI | InChI=1S/C25H25N5O4/c1-34-23-7-3-5-19(15-23)17-27-29-24(32)12-13-26-21-10-8-20(9-11-21)25(33)30-28-16-18-4-2-6-22(31)14-18/h2-11,14-17,26,31H,12-13H2,1H3,(H,29,32)(H,30,33)/b27-17+,28-16+ |
| InChIKey | VBXBBKLGWHVOSI-NBCKFKMNSA-N |
| XLogP | 3.12 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|