C16H15FN2O3 — CID 2641916
N-[(3,5-dimethoxyphenyl)methylideneamino]-4-fluorobenzamide (PubChem CID 2641916) has the molecular formula C16H15FN2O3 and a molecular weight of 302.31 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methylideneamino]-4-fluorobenzamide.
| Compound Name | N-[(3,5-dimethoxyphenyl)methylideneamino]-4-fluorobenzamide |
|---|---|
| PubChem CID | 2641916 |
| Molecular Formula | C16H15FN2O3 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methylideneamino]-4-fluorobenzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc(F)cc2)cc(OC)c1 |
| InChI | InChI=1S/C16H15FN2O3/c1-21-14-7-11(8-15(9-14)22-2)10-18-19-16(20)12-3-5-13(17)6-4-12/h3-10H,1-2H3,(H,19,20) |
| InChIKey | PPTPRVFCJKKGRW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|