C17H14ClN3O — CID 23476934
2-chloro-N-[(E)-(1-methylindol-3-yl)methylideneamino]benzamide (PubChem CID 23476934) has the molecular formula C17H14ClN3O and a molecular weight of 311.77 g/mol. Its IUPAC name is 2-chloro-N-[(E)-(1-methylindol-3-yl)methylideneamino]benzamide.
| Compound Name | 2-chloro-N-[(E)-(1-methylindol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 23476934 |
| Molecular Formula | C17H14ClN3O |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-chloro-N-[(E)-(1-methylindol-3-yl)methylideneamino]benzamide |
| SMILES | Cn1cc(/C=N/NC(=O)c2ccccc2Cl)c2ccccc21 |
| InChI | InChI=1S/C17H14ClN3O/c1-21-11-12(13-6-3-5-9-16(13)21)10-19-20-17(22)14-7-2-4-8-15(14)18/h2-11H,1H3,(H,20,22)/b19-10+ |
| InChIKey | RFGYTRRCILLSHM-VXLYETTFSA-N |
| XLogP | 3.60 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|