C24H21N3O3 — CID 17126770
3,5-dihydroxy-N-[(E)-[1-[(2-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide (PubChem CID 17126770) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3,5-dihydroxy-N-[(E)-[1-[(2-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide.
| Compound Name | 3,5-dihydroxy-N-[(E)-[1-[(2-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 17126770 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3,5-dihydroxy-N-[(E)-[1-[(2-methylphenyl)methyl]indol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1ccccc1Cn1cc(/C=N/NC(=O)c2cc(O)cc(O)c2)c2ccccc21 |
| InChI | InChI=1S/C24H21N3O3/c1-16-6-2-3-7-17(16)14-27-15-19(22-8-4-5-9-23(22)27)13-25-26-24(30)18-10-20(28)12-21(29)11-18/h2-13,15,28-29H,14H2,1H3,(H,26,30)/b25-13+ |
| InChIKey | CNFXUBOJQCPAMH-DHRITJCHSA-N |
| XLogP | 4.17 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|