C24H20FN3O — CID 19060958
N-[(E)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-2-methylbenzamide (PubChem CID 19060958) has the molecular formula C24H20FN3O and a molecular weight of 385.44 g/mol. Its IUPAC name is N-[(E)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-2-methylbenzamide.
| Compound Name | N-[(E)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-2-methylbenzamide |
|---|---|
| PubChem CID | 19060958 |
| Molecular Formula | C24H20FN3O |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[(E)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N/N=C/c1cn(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C24H20FN3O/c1-17-6-2-3-7-21(17)24(29)27-26-14-19-16-28(23-9-5-4-8-22(19)23)15-18-10-12-20(25)13-11-18/h2-14,16H,15H2,1H3,(H,27,29)/b26-14+ |
| InChIKey | RIASYFSPEZPIND-VULFUBBASA-N |
| XLogP | 4.90 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|