C25H22FN3O3 — CID 6144806
N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-2,4-dimethoxybenzamide (PubChem CID 6144806) has the molecular formula C25H22FN3O3 and a molecular weight of 431.47 g/mol. Its IUPAC name is N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-2,4-dimethoxybenzamide.
| Compound Name | N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 6144806 |
| Molecular Formula | C25H22FN3O3 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2cn(Cc3ccc(F)cc3)c3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C25H22FN3O3/c1-31-20-11-12-22(24(13-20)32-2)25(30)28-27-14-18-16-29(23-6-4-3-5-21(18)23)15-17-7-9-19(26)10-8-17/h3-14,16H,15H2,1-2H3,(H,28,30)/b27-14- |
| InChIKey | ZTPYIUKOEPCXPE-VYYCAZPPSA-N |
| XLogP | 4.61 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|