C24H22FN3O — CID 17245785
N-[(E)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-1-(2-methoxyphenyl)methanamine (PubChem CID 17245785) has the molecular formula C24H22FN3O and a molecular weight of 387.46 g/mol. Its IUPAC name is N-[(E)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-1-(2-methoxyphenyl)methanamine.
| Compound Name | N-[(E)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-1-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 17245785 |
| Molecular Formula | C24H22FN3O |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-[(E)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-1-(2-methoxyphenyl)methanamine |
| SMILES | COc1ccccc1CN/N=C/c1cn(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C24H22FN3O/c1-29-24-9-5-2-6-19(24)14-26-27-15-20-17-28(23-8-4-3-7-22(20)23)16-18-10-12-21(25)13-11-18/h2-13,15,17,26H,14,16H2,1H3/b27-15+ |
| InChIKey | YNQVHLIESFOZCI-JFLMPSFJSA-N |
| XLogP | 4.96 |
| TPSA | 38.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|