C26H24N4O2 — CID 133169278
3-[[3-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]indol-1-yl]methyl]benzonitrile (PubChem CID 133169278) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-[[3-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]indol-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[3-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]indol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 133169278 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 3-[[3-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]indol-1-yl]methyl]benzonitrile |
| SMILES | COc1ccc(CN/N=C/c2cn(Cc3cccc(C#N)c3)c3ccccc23)cc1OC |
| InChI | InChI=1S/C26H24N4O2/c1-31-25-11-10-20(13-26(25)32-2)15-28-29-16-22-18-30(24-9-4-3-8-23(22)24)17-21-7-5-6-19(12-21)14-27/h3-13,16,18,28H,15,17H2,1-2H3/b29-16+ |
| InChIKey | QSILOQPKWBWSSE-MUFRIFMGSA-N |
| XLogP | 4.70 |
| TPSA | 71.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|