C24H18Cl2N4 — CID 19060384
3-[[3-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]indol-1-yl]methyl]benzonitrile (PubChem CID 19060384) has the molecular formula C24H18Cl2N4 and a molecular weight of 433.34 g/mol. Its IUPAC name is 3-[[3-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]indol-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[3-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]indol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 19060384 |
| Molecular Formula | C24H18Cl2N4 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 3-[[3-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]indol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(Cn2cc(/C=N/NCc3c(Cl)cccc3Cl)c3ccccc32)c1 |
| InChI | InChI=1S/C24H18Cl2N4/c25-22-8-4-9-23(26)21(22)14-29-28-13-19-16-30(24-10-2-1-7-20(19)24)15-18-6-3-5-17(11-18)12-27/h1-11,13,16,29H,14-15H2/b28-13+ |
| InChIKey | MZVGZONURLBRMQ-XODNFHPESA-N |
| XLogP | 5.99 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|