C24H20Cl3N3O2 — CID 19060332
3-[[2-chloro-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-6-ethoxyphenoxy]methyl]benzonitrile (PubChem CID 19060332) has the molecular formula C24H20Cl3N3O2 and a molecular weight of 488.80 g/mol. Its IUPAC name is 3-[[2-chloro-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-6-ethoxyphenoxy]methyl]benzonitrile.
| Compound Name | 3-[[2-chloro-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-6-ethoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 19060332 |
| Molecular Formula | C24H20Cl3N3O2 |
| Molecular Weight | 488.80 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 3-[[2-chloro-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-6-ethoxyphenoxy]methyl]benzonitrile |
| SMILES | CCOc1cc(/C=N/NCc2c(Cl)cccc2Cl)cc(Cl)c1OCc1cccc(C#N)c1 |
| InChI | InChI=1S/C24H20Cl3N3O2/c1-2-31-23-11-18(13-29-30-14-19-20(25)7-4-8-21(19)26)10-22(27)24(23)32-15-17-6-3-5-16(9-17)12-28/h3-11,13,30H,2,14-15H2,1H3/b29-13+ |
| InChIKey | HUGXEHGEJZCNOO-VFLNYLIXSA-N |
| XLogP | 6.62 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.80 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|