C25H21Br2N3O3 — CID 98050694
N-[(Z)-[3-bromo-4-[(3-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-bromophenyl)acetamide (PubChem CID 98050694) has the molecular formula C25H21Br2N3O3 and a molecular weight of 571.27 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(3-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-bromophenyl)acetamide.
| Compound Name | N-[(Z)-[3-bromo-4-[(3-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-bromophenyl)acetamide |
|---|---|
| PubChem CID | 98050694 |
| Molecular Formula | C25H21Br2N3O3 |
| Molecular Weight | 571.27 g/mol |
| Exact Mass | 568.99 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(3-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-bromophenyl)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)Cc2ccc(Br)cc2)cc(Br)c1OCc1cccc(C#N)c1 |
| InChI | InChI=1S/C25H21Br2N3O3/c1-2-32-23-12-20(15-29-30-24(31)13-17-6-8-21(26)9-7-17)11-22(27)25(23)33-16-19-5-3-4-18(10-19)14-28/h3-12,15H,2,13,16H2,1H3,(H,30,31)/b29-15- |
| InChIKey | HFSKEALXXDRKOS-FDVSRXAVSA-N |
| XLogP | 5.75 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.27 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|