C18H18Br2N2O3 — CID 93066684
N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(4-bromophenyl)acetamide (PubChem CID 93066684) has the molecular formula C18H18Br2N2O3 and a molecular weight of 470.16 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(4-bromophenyl)acetamide.
| Compound Name | N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(4-bromophenyl)acetamide |
|---|---|
| PubChem CID | 93066684 |
| Molecular Formula | C18H18Br2N2O3 |
| Molecular Weight | 470.16 g/mol |
| Exact Mass | 467.97 |
| IUPAC Name | N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(4-bromophenyl)acetamide |
| SMILES | CCOc1c(Br)cc(/C=N/NC(=O)Cc2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C18H18Br2N2O3/c1-3-25-18-15(20)8-13(9-16(18)24-2)11-21-22-17(23)10-12-4-6-14(19)7-5-12/h4-9,11H,3,10H2,1-2H3,(H,22,23)/b21-11+ |
| InChIKey | WYHPSRZYEDRBHV-SRZZPIQSSA-N |
| XLogP | 4.31 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.16 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|