C24H21BrCl2N2O3 — CID 4548151
N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-chlorophenyl)acetamide (PubChem CID 4548151) has the molecular formula C24H21BrCl2N2O3 and a molecular weight of 536.25 g/mol. Its IUPAC name is N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 4548151 |
| Molecular Formula | C24H21BrCl2N2O3 |
| Molecular Weight | 536.25 g/mol |
| Exact Mass | 534.01 |
| IUPAC Name | N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-chlorophenyl)acetamide |
| SMILES | CCOc1cc(C=NNC(=O)Cc2ccc(Cl)cc2)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H21BrCl2N2O3/c1-2-31-22-12-17(14-28-29-23(30)13-16-7-9-19(26)10-8-16)11-20(25)24(22)32-15-18-5-3-4-6-21(18)27/h3-12,14H,2,13,15H2,1H3,(H,29,30) |
| InChIKey | XVEFHUYPHQWOEM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.25 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|