C25H23BrN2O5 — CID 3668001
2-(1,3-benzodioxol-5-yl)-N-[(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 3668001) has the molecular formula C25H23BrN2O5 and a molecular weight of 511.37 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3668001 |
| Molecular Formula | C25H23BrN2O5 |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1cc(C=NNC(=O)Cc2ccc3c(c2)OCO3)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H23BrN2O5/c1-2-30-23-12-19(10-20(26)25(23)31-15-17-6-4-3-5-7-17)14-27-28-24(29)13-18-8-9-21-22(11-18)33-16-32-21/h3-12,14H,2,13,15-16H2,1H3,(H,28,29) |
| InChIKey | QKKIAUQQNVVBRS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|