C24H20BrIN2O5 — CID 126168423
2-(1,3-benzodioxol-5-yl)-N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]acetamide (PubChem CID 126168423) has the molecular formula C24H20BrIN2O5 and a molecular weight of 623.24 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126168423 |
| Molecular Formula | C24H20BrIN2O5 |
| Molecular Weight | 623.24 g/mol |
| Exact Mass | 621.96 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)Cc2ccc3c(c2)OCO3)cc(I)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H20BrIN2O5/c1-30-22-10-17(8-19(26)24(22)31-13-15-2-5-18(25)6-3-15)12-27-28-23(29)11-16-4-7-20-21(9-16)33-14-32-20/h2-10,12H,11,13-14H2,1H3,(H,28,29)/b27-12- |
| InChIKey | RWSYNFHTZUTJOZ-PPDIBHTLSA-N |
| XLogP | 5.06 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.24 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|