C25H21Br2N3O6 — CID 3585836
N-[2-[2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 3585836) has the molecular formula C25H21Br2N3O6 and a molecular weight of 619.27 g/mol. Its IUPAC name is N-[2-[2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3585836 |
| Molecular Formula | C25H21Br2N3O6 |
| Molecular Weight | 619.27 g/mol |
| Exact Mass | 616.98 |
| IUPAC Name | N-[2-[2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1cc(C=NNC(=O)CNC(=O)c2ccc3c(c2)OCO3)cc(Br)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C25H21Br2N3O6/c1-33-22-9-16(8-19(27)24(22)34-13-15-2-5-18(26)6-3-15)11-29-30-23(31)12-28-25(32)17-4-7-20-21(10-17)36-14-35-20/h2-11H,12-14H2,1H3,(H,28,32)(H,30,31) |
| InChIKey | DOELJWMJBIJGHW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|