C24H20BrN3O5 — CID 4528391
N-[2-[2-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 4528391) has the molecular formula C24H20BrN3O5 and a molecular weight of 510.34 g/mol. Its IUPAC name is N-[2-[2-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[2-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 4528391 |
| Molecular Formula | C24H20BrN3O5 |
| Molecular Weight | 510.34 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | N-[2-[2-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc2c(c1)OCO2)NN=Cc1ccccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H20BrN3O5/c25-19-8-5-16(6-9-19)14-31-20-4-2-1-3-18(20)12-27-28-23(29)13-26-24(30)17-7-10-21-22(11-17)33-15-32-21/h1-12H,13-15H2,(H,26,30)(H,28,29) |
| InChIKey | USKOEJOHBHOCCQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|