C24H19Cl2N3O5 — CID 3375336
N-[2-[2-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 3375336) has the molecular formula C24H19Cl2N3O5 and a molecular weight of 500.34 g/mol. Its IUPAC name is N-[2-[2-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[2-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3375336 |
| Molecular Formula | C24H19Cl2N3O5 |
| Molecular Weight | 500.34 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | N-[2-[2-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc2c(c1)OCO2)NN=Cc1ccccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H19Cl2N3O5/c25-18-7-5-15(9-19(18)26)13-32-20-4-2-1-3-17(20)11-28-29-23(30)12-27-24(31)16-6-8-21-22(10-16)34-14-33-21/h1-11H,12-14H2,(H,27,31)(H,29,30) |
| InChIKey | CKWQXHIHROROOS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|