C30H21Cl2N3O6 — CID 3864023
[3-benzoyloxy-4-[[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 3864023) has the molecular formula C30H21Cl2N3O6 and a molecular weight of 590.42 g/mol. Its IUPAC name is [3-benzoyloxy-4-[[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [3-benzoyloxy-4-[[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 3864023 |
| Molecular Formula | C30H21Cl2N3O6 |
| Molecular Weight | 590.42 g/mol |
| Exact Mass | 589.08 |
| IUPAC Name | [3-benzoyloxy-4-[[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1)NN=Cc1ccc(OC(=O)c2ccccc2)cc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H21Cl2N3O6/c31-24-14-12-21(15-25(24)32)28(37)33-18-27(36)35-34-17-22-11-13-23(40-29(38)19-7-3-1-4-8-19)16-26(22)41-30(39)20-9-5-2-6-10-20/h1-17H,18H2,(H,33,37)(H,35,36) |
| InChIKey | WQIWIDZFNLOIPI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|