C33H29N3O9 — CID 3636637
[3-benzoyloxy-4-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 3636637) has the molecular formula C33H29N3O9 and a molecular weight of 611.61 g/mol. Its IUPAC name is [3-benzoyloxy-4-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [3-benzoyloxy-4-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 3636637 |
| Molecular Formula | C33H29N3O9 |
| Molecular Weight | 611.61 g/mol |
| Exact Mass | 611.19 |
| IUPAC Name | [3-benzoyloxy-4-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | COc1cc(C(=O)NCC(=O)NN=Cc2ccc(OC(=O)c3ccccc3)cc2OC(=O)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C33H29N3O9/c1-41-27-16-24(17-28(42-2)30(27)43-3)31(38)34-20-29(37)36-35-19-23-14-15-25(44-32(39)21-10-6-4-7-11-21)18-26(23)45-33(40)22-12-8-5-9-13-22/h4-19H,20H2,1-3H3,(H,34,38)(H,36,37) |
| InChIKey | GDKUIIVDIOASJI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 150.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|