C26H23BrClN3O7 — CID 3748834
[4-bromo-2-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 3748834) has the molecular formula C26H23BrClN3O7 and a molecular weight of 604.84 g/mol. Its IUPAC name is [4-bromo-2-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-bromo-2-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 3748834 |
| Molecular Formula | C26H23BrClN3O7 |
| Molecular Weight | 604.84 g/mol |
| Exact Mass | 603.04 |
| IUPAC Name | [4-bromo-2-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | COc1cc(C(=O)NCC(=O)NN=Cc2cc(Br)ccc2OC(=O)c2ccc(Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H23BrClN3O7/c1-35-21-11-16(12-22(36-2)24(21)37-3)25(33)29-14-23(32)31-30-13-17-10-18(27)6-9-20(17)38-26(34)15-4-7-19(28)8-5-15/h4-13H,14H2,1-3H3,(H,29,33)(H,31,32) |
| InChIKey | JEHREZVTAJBDCR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.84 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|