C25H25N3O6 — CID 3274051
3,4,5-trimethoxy-N-[2-oxo-2-[2-[(3-phenoxyphenyl)methylidene]hydrazinyl]ethyl]benzamide (PubChem CID 3274051) has the molecular formula C25H25N3O6 and a molecular weight of 463.49 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-oxo-2-[2-[(3-phenoxyphenyl)methylidene]hydrazinyl]ethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-oxo-2-[2-[(3-phenoxyphenyl)methylidene]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 3274051 |
| Molecular Formula | C25H25N3O6 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-oxo-2-[2-[(3-phenoxyphenyl)methylidene]hydrazinyl]ethyl]benzamide |
| SMILES | COc1cc(C(=O)NCC(=O)NN=Cc2cccc(Oc3ccccc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H25N3O6/c1-31-21-13-18(14-22(32-2)24(21)33-3)25(30)26-16-23(29)28-27-15-17-8-7-11-20(12-17)34-19-9-5-4-6-10-19/h4-15H,16H2,1-3H3,(H,26,30)(H,28,29) |
| InChIKey | BLDLTZHGWBDXCQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|