C24H23N3O7S — CID 5187244
[4-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate (PubChem CID 5187244) has the molecular formula C24H23N3O7S and a molecular weight of 497.53 g/mol. Its IUPAC name is [4-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [4-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 5187244 |
| Molecular Formula | C24H23N3O7S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | [4-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(C(=O)NCC(=O)NN=Cc2ccc(OC(=O)c3cccs3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H23N3O7S/c1-31-18-11-16(12-19(32-2)22(18)33-3)23(29)25-14-21(28)27-26-13-15-6-8-17(9-7-15)34-24(30)20-5-4-10-35-20/h4-13H,14H2,1-3H3,(H,25,29)(H,27,28) |
| InChIKey | BMDBWUDTBBAGMG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|