C24H31N3O4S — CID 6079659
[4-[(E)-[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate (PubChem CID 6079659) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is [4-[(E)-[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(E)-[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 6079659 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | [4-[(E)-[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
| SMILES | CCCCCCCCCC(=O)NCC(=O)N/N=C/c1ccc(OC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C24H31N3O4S/c1-2-3-4-5-6-7-8-11-22(28)25-18-23(29)27-26-17-19-12-14-20(15-13-19)31-24(30)21-10-9-16-32-21/h9-10,12-17H,2-8,11,18H2,1H3,(H,25,28)(H,27,29)/b26-17+ |
| InChIKey | WLZHOTNKNVLPSV-YZSQISJMSA-N |
| XLogP | 4.67 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|