C31H25N3O6 — CID 6008323
[3-benzoyloxy-4-[(Z)-[[2-[(3-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 6008323) has the molecular formula C31H25N3O6 and a molecular weight of 535.56 g/mol. Its IUPAC name is [3-benzoyloxy-4-[(Z)-[[2-[(3-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [3-benzoyloxy-4-[(Z)-[[2-[(3-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 6008323 |
| Molecular Formula | C31H25N3O6 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | [3-benzoyloxy-4-[(Z)-[[2-[(3-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | Cc1cccc(C(=O)NCC(=O)N/N=C\c2ccc(OC(=O)c3ccccc3)cc2OC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C31H25N3O6/c1-21-9-8-14-24(17-21)29(36)32-20-28(35)34-33-19-25-15-16-26(39-30(37)22-10-4-2-5-11-22)18-27(25)40-31(38)23-12-6-3-7-13-23/h2-19H,20H2,1H3,(H,32,36)(H,34,35)/b33-19- |
| InChIKey | WPMRPQHIGOYREP-APTWKGOFSA-N |
| XLogP | 4.31 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|