C30H19Cl4N3O6 — CID 3311927
[3-(4-chlorobenzoyl)oxy-4-[[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 3311927) has the molecular formula C30H19Cl4N3O6 and a molecular weight of 659.31 g/mol. Its IUPAC name is [3-(4-chlorobenzoyl)oxy-4-[[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [3-(4-chlorobenzoyl)oxy-4-[[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 3311927 |
| Molecular Formula | C30H19Cl4N3O6 |
| Molecular Weight | 659.31 g/mol |
| Exact Mass | 657.00 |
| IUPAC Name | [3-(4-chlorobenzoyl)oxy-4-[[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1)NN=Cc1ccc(OC(=O)c2ccc(Cl)cc2)cc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H19Cl4N3O6/c31-21-7-1-17(2-8-21)29(40)42-23-11-5-20(26(14-23)43-30(41)18-3-9-22(32)10-4-18)15-36-37-27(38)16-35-28(39)19-6-12-24(33)25(34)13-19/h1-15H,16H2,(H,35,39)(H,37,38) |
| InChIKey | UTHFTLJZCQZQSW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.31 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|