C27H17Cl2N3O5 — CID 6271069
[3-(4-chlorobenzoyl)oxy-4-[(Z)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate (PubChem CID 6271069) has the molecular formula C27H17Cl2N3O5 and a molecular weight of 534.36 g/mol. Its IUPAC name is [3-(4-chlorobenzoyl)oxy-4-[(Z)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [3-(4-chlorobenzoyl)oxy-4-[(Z)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 6271069 |
| Molecular Formula | C27H17Cl2N3O5 |
| Molecular Weight | 534.36 g/mol |
| Exact Mass | 533.05 |
| IUPAC Name | [3-(4-chlorobenzoyl)oxy-4-[(Z)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate |
| SMILES | O=C(N/N=C\c1ccc(OC(=O)c2ccc(Cl)cc2)cc1OC(=O)c1ccc(Cl)cc1)c1ccncc1 |
| InChI | InChI=1S/C27H17Cl2N3O5/c28-21-6-1-18(2-7-21)26(34)36-23-10-5-20(16-31-32-25(33)17-11-13-30-14-12-17)24(15-23)37-27(35)19-3-8-22(29)9-4-19/h1-16H,(H,32,33)/b31-16- |
| InChIKey | XCTHTJFPRLWNCW-ACXHZZMFSA-N |
| XLogP | 5.59 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.36 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|