C27H19N3O5 — CID 5106665
[3-benzoyloxy-4-[(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] benzoate (PubChem CID 5106665) has the molecular formula C27H19N3O5 and a molecular weight of 465.47 g/mol. Its IUPAC name is [3-benzoyloxy-4-[(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] benzoate.
| Compound Name | [3-benzoyloxy-4-[(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 5106665 |
| Molecular Formula | C27H19N3O5 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | [3-benzoyloxy-4-[(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] benzoate |
| SMILES | O=C(NN=Cc1ccc(OC(=O)c2ccccc2)cc1OC(=O)c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C27H19N3O5/c31-25(19-13-15-28-16-14-19)30-29-18-22-11-12-23(34-26(32)20-7-3-1-4-8-20)17-24(22)35-27(33)21-9-5-2-6-10-21/h1-18H,(H,30,31) |
| InChIKey | AHEWYZAATOAYRT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|